![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | zelootma.zip | 2020-09-18 11:51 | 30M | |
![[ ]](/icons/compressed.gif) | violencekiller.zip | 2020-09-18 11:51 | 27M | |
![[ ]](/icons/compressed.gif) | telefoot soccer 2000 (f) [f1] (ntsc).zip | 2020-09-18 11:51 | 12M | |
![[ ]](/icons/compressed.gif) | superman64_prototype_resized.zip | 2020-09-18 11:51 | 4.5M | |
![[ ]](/icons/compressed.gif) | superman64_prototype_raw.zip | 2020-09-18 11:51 | 4.5M | |
![[ ]](/icons/compressed.gif) | sm64 relaxing is over.ext.zip | 2020-09-18 11:51 | 10M | |
![[ ]](/icons/unknown.gif) | retroarch.php | 2020-09-18 11:51 | 37 | |
![[ ]](/icons/compressed.gif) | oot4.zip | 2020-09-18 11:51 | 30M | |
![[ ]](/icons/compressed.gif) | mario64hackLEVELTESTING.ext.zip | 2020-09-18 11:51 | 9.4M | |
![[ ]](/icons/compressed.gif) | dragon-sword-64.zip | 2020-09-18 11:51 | 7.0M | |
![[ ]](/icons/compressed.gif) | conker_bfd_ects_DC.zip | 2020-09-18 11:52 | 51M | |
![[ ]](/icons/compressed.gif) | Zool - Majuu Tsukai Densetsu (Japan).zip | 2020-09-18 11:51 | 7.8M | |
![[ ]](/icons/compressed.gif) | Zelda no Densetsu - Mujura no Kamen (J) (V1.1) [!].zip | 2020-09-18 11:52 | 27M | |
![[ ]](/icons/compressed.gif) | ZeldaSM64alpha (Unknown).ext.zip | 2020-09-18 11:51 | 10M | |
![[ ]](/icons/compressed.gif) | Zelda-Voyager of Time.zip | 2020-09-18 11:52 | 30M | |
![[ ]](/icons/compressed.gif) | Yoshi's Story (U) [!].zip | 2020-09-18 11:51 | 9.2M | |
![[ ]](/icons/compressed.gif) | Xplorer 64 (Germany) (v1.067) (Unl).zip | 2020-09-18 11:51 | 117K | |
![[ ]](/icons/compressed.gif) | Xena Warrior Princess - The Talisman of Fate (U) [!].zip | 2020-09-18 11:52 | 9.9M | |
![[ ]](/icons/compressed.gif) | Worms - Armageddon (U) (M3) [!].zip | 2020-09-18 11:52 | 9.1M | |
![[ ]](/icons/compressed.gif) | World Driver Championship (U) [!].zip | 2020-09-18 11:52 | 14M | |
![[ ]](/icons/compressed.gif) | World Cup 98 (U) [!].zip | 2020-09-18 11:52 | 11M | |
![[ ]](/icons/compressed.gif) | Wonder Project J2 - Koruro no Mori no Jozet (Japan).zip | 2020-09-18 11:52 | 5.9M | |
![[ ]](/icons/compressed.gif) | Wonder Project J2 (english translation).zip | 2020-09-18 11:52 | 5.8M | |
![[ ]](/icons/compressed.gif) | Wipeout 64 (U) [!].zip | 2020-09-18 11:52 | 5.8M | |
![[ ]](/icons/compressed.gif) | WinBack - Covert Operations (U) [!].zip | 2020-09-18 11:52 | 10M | |
![[ ]](/icons/compressed.gif) | Wildwaters (Unreleased) - CARROT.zip | 2020-09-18 11:52 | 10M | |
![[ ]](/icons/compressed.gif) | Wheel of Fortune (U) [!].zip | 2020-09-18 11:52 | 2.1M | |
![[ ]](/icons/compressed.gif) | Wetrix (U) [!].zip | 2020-09-18 11:52 | 5.1M | |
![[ ]](/icons/compressed.gif) | Wayne Gretzky's 3D Hockey (U) (V1.1) [!].zip | 2020-09-18 11:52 | 6.8M | |
![[ ]](/icons/compressed.gif) | Wayne Gretzky's 3D Hockey '98 (U) [!].zip | 2020-09-18 11:52 | 6.9M | |
![[ ]](/icons/compressed.gif) | Wave Race 64 (U) (V1.1) [!].zip | 2020-09-18 11:52 | 5.9M | |
![[ ]](/icons/compressed.gif) | Wave Race 64 (Japan) (Rev B) (Shindou Edition).zip | 2020-09-18 11:52 | 6.0M | |
![[ ]](/icons/compressed.gif) | Wariovs.MD [FrittenFriseurLPs].zip | 2020-09-18 11:52 | 9.5M | |
![[ ]](/icons/compressed.gif) | War Gods (U) [!].zip | 2020-09-18 11:52 | 10M | |
![[ ]](/icons/compressed.gif) | Waialae Country Club - True Golf Classics (U) [!].zip | 2020-09-18 11:52 | 14M | |
![[ ]](/icons/compressed.gif) | WWF WrestleMania 2000 (U) [!].zip | 2020-09-18 11:52 | 21M | |
![[ ]](/icons/compressed.gif) | WWF No Mercy (U) [!].zip | 2020-09-18 11:52 | 25M | |
![[ ]](/icons/compressed.gif) | WWF Attitude (U) [!].zip | 2020-09-18 11:52 | 29M | |
![[ ]](/icons/compressed.gif) | WWF - War Zone (U) [!].zip | 2020-09-18 11:52 | 11M | |
![[ ]](/icons/compressed.gif) | WCW vs. nWo - World Tour (U) (V1.1) [!].zip | 2020-09-18 11:52 | 7.8M | |
![[ ]](/icons/compressed.gif) | WCW Nitro (U) [!].zip | 2020-09-18 11:52 | 7.4M | |
![[ ]](/icons/compressed.gif) | WCW Mayhem (U) [!].zip | 2020-09-18 11:52 | 13M | |
![[ ]](/icons/compressed.gif) | WCW Backstage Assault (U) [!].zip | 2020-09-18 11:52 | 26M | |
![[ ]](/icons/compressed.gif) | WCW-nWo Revenge (U) [!].zip | 2020-09-18 11:52 | 12M | |
![[ ]](/icons/compressed.gif) | Virtual Pro Wrestling 64 (Japan).zip | 2020-09-18 11:52 | 11M | |
![[ ]](/icons/compressed.gif) | Virtual Pro Wrestling 2 - Oudou Keishou (Japan).zip | 2020-09-18 11:52 | 25M | |
![[ ]](/icons/compressed.gif) | Virtual Pool 64 (U) [!].zip | 2020-09-18 11:52 | 4.7M | |
![[ ]](/icons/compressed.gif) | Virtual Chess 64 (U) [!].zip | 2020-09-18 11:52 | 2.7M | |
![[ ]](/icons/compressed.gif) | Vigilante 8 - 2nd Offense (U) [!].zip | 2020-09-18 11:52 | 11M | |
![[ ]](/icons/compressed.gif) | Vigilante 8 (U) [!].zip | 2020-09-18 11:52 | 7.1M | |
![[ ]](/icons/compressed.gif) | V-Rally Edition 99 (U) [!].zip | 2020-09-18 11:52 | 6.8M | |
![[ ]](/icons/compressed.gif) | Utchan Nanchan no Hono no Challenger - Denryuu Ira Ira Bou (Japan).zip | 2020-09-18 11:52 | 3.2M | |
![[ ]](/icons/compressed.gif) | Uber Mario 64 (demo).ext.zip | 2020-09-18 11:52 | 8.7M | |
![[ ]](/icons/compressed.gif) | Twisted Edge Extreme Snowboarding (U) [!].zip | 2020-09-18 11:52 | 9.9M | |
![[ ]](/icons/compressed.gif) | Turok 3 - Shadow of Oblivion (U) [!].zip | 2020-09-18 11:53 | 27M | |
![[ ]](/icons/compressed.gif) | Turok 2 - Seeds of Evil - Kiosk (U) [!].zip | 2020-09-18 11:52 | 9.2M | |
![[ ]](/icons/compressed.gif) | Turok 2 - Seeds of Evil (U) [!].zip | 2020-09-18 11:53 | 28M | |
![[ ]](/icons/compressed.gif) | Turok - Rage Wars (U) [!].zip | 2020-09-18 11:52 | 5.4M | |
![[ ]](/icons/compressed.gif) | Turok - Dinosaur Hunter (U) (V1.2) [!].zip | 2020-09-18 11:52 | 7.2M | |
![[ ]](/icons/compressed.gif) | Tsumi to Batsu.zip | 2020-09-18 11:53 | 24M | |
![[ ]](/icons/compressed.gif) | TsucnenTs_Treasures_2.zip | 2020-09-18 11:52 | 9.5M | |
![[ ]](/icons/compressed.gif) | TsucnenTs_Treasures.zip | 2020-09-18 11:52 | 9.6M | |
![[ ]](/icons/compressed.gif) | Triple Play 2000 (U) [!].zip | 2020-09-18 11:53 | 13M | |
![[ ]](/icons/compressed.gif) | Transformers - Beast Wars Transmetal (U) [!].zip | 2020-09-18 11:53 | 8.5M | |
![[ ]](/icons/compressed.gif) | Toy Story 2 (U) [!].zip | 2020-09-18 11:53 | 9.6M | |
![[ ]](/icons/compressed.gif) | Top Gear Rally 2 (U) [!].zip | 2020-09-18 11:53 | 10M | |
![[ ]](/icons/compressed.gif) | Top Gear Rally (U) [!].zip | 2020-09-18 11:53 | 5.3M | |
![[ ]](/icons/compressed.gif) | Top Gear Overdrive (U) [!].zip | 2020-09-18 11:53 | 11M | |
![[ ]](/icons/compressed.gif) | Top Gear Hyper Bike (U) [!].zip | 2020-09-18 11:53 | 15M | |
![[ ]](/icons/compressed.gif) | Toon Panic (Japan) (Proto).zip | 2020-09-18 11:53 | 5.3M | |
![[ ]](/icons/compressed.gif) | Tony Hawks Pro Skater 2 (U) [!].zip | 2020-09-18 11:53 | 15M | |
![[ ]](/icons/compressed.gif) | Tony Hawk's Pro Skater 3 (U).zip | 2020-09-18 11:53 | 14M | |
![[ ]](/icons/compressed.gif) | Tony Hawk's Pro Skater (U) [!].zip | 2020-09-18 11:53 | 12M | |
![[ ]](/icons/compressed.gif) | Tonic Trouble (U) (V1.1) [!].zip | 2020-09-18 11:53 | 10M | |
![[ ]](/icons/compressed.gif) | Tom and Jerry in Fists of Furry (U) [!].zip | 2020-09-18 11:53 | 7.8M | |
![[ ]](/icons/compressed.gif) | Tom Clancy's Rainbow Six (U) [!].zip | 2020-09-18 11:53 | 13M | |
![[ ]](/icons/compressed.gif) | Tigger's Honey Hunt (U) [!].zip | 2020-09-18 11:53 | 12M | |
![[ ]](/icons/compressed.gif) | Tetrisphere (U) [!].zip | 2020-09-18 11:53 | 6.4M | |
![[ ]](/icons/compressed.gif) | Tetris 64 (Japan).zip | 2020-09-18 11:53 | 6.4M | |
![[ ]](/icons/compressed.gif) | Temple Explorer 64.zip | 2020-09-18 11:53 | 9.3M | |
![[ ]](/icons/compressed.gif) | TempleExplorer.zip | 2020-09-18 11:53 | 9.7M | |
![[ ]](/icons/compressed.gif) | Taz Express (E) [!].zip | 2020-09-18 11:53 | 10M | |
![[ ]](/icons/compressed.gif) | Tamiya Racing 64 (Unreleased) - CARROT.zip | 2020-09-18 11:53 | 7.6M | |
![[ ]](/icons/compressed.gif) | Sydney 2000 (Unreleased) (U).zip | 2020-09-18 11:53 | 24M | |
![[ ]](/icons/compressed.gif) | Susume! Taisen Puzzle Dama - Toukon! Marutama Chou (Japan).zip | 2020-09-18 11:53 | 5.9M | |
![[ ]](/icons/compressed.gif) | Super mario 64 - The Secret Stars.zip | 2020-09-18 11:53 | 9.2M | |
![[ ]](/icons/compressed.gif) | Superman (U) (M3) [!].zip | 2020-09-18 11:53 | 5.0M | |
![[ ]](/icons/compressed.gif) | Super luigi majora's 64.zip | 2020-09-18 11:53 | 8.7M | |
![[ ]](/icons/compressed.gif) | Supercross 2000 (U) [!].zip | 2020-09-18 11:53 | 14M | |
![[ ]](/icons/compressed.gif) | Super Wario 64 (Super Mario 64 Hack).zip | 2020-09-18 11:53 | 8.7M | |
![[ ]](/icons/compressed.gif) | Super Trash 64.ext.zip | 2020-09-18 11:53 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Sonic 64 (U) [!].ext.zip | 2020-09-18 11:53 | 8.4M | |
![[ ]](/icons/compressed.gif) | Super Smash Bros. (U) [!].zip | 2020-09-18 11:53 | 12M | |
![[ ]](/icons/compressed.gif) | Super Robot Taisen 64 (Japan).zip | 2020-09-18 11:53 | 23M | |
![[ ]](/icons/compressed.gif) | Super Robot Spirits (Japan).zip | 2020-09-18 11:53 | 7.8M | |
![[ ]](/icons/compressed.gif) | Super Robot Mario 64.ext.zip | 2020-09-18 11:53 | 8.6M | |
![[ ]](/icons/compressed.gif) | Super Pantufa Deux 1-1 in Mario 64.zip | 2020-09-18 11:53 | 9.1M | |
![[ ]](/icons/compressed.gif) | Super Mario and Planet Stardust's Rampage (v1.0).zip | 2020-09-18 11:53 | 8.6M | |
![[ ]](/icons/compressed.gif) | Super Mario Warp Zone Secret Star Zone.zip | 2020-09-18 11:53 | 9.5M | |
![[ ]](/icons/compressed.gif) | Super Mario Warp Zone Alternative Version.zip | 2020-09-18 11:53 | 9.5M | |
![[ ]](/icons/compressed.gif) | Super Mario Warp Zone 2.zip | 2020-09-18 11:53 | 10M | |
![[ ]](/icons/compressed.gif) | Super Mario Warp Zone.zip | 2020-09-18 11:53 | 9.5M | |
![[ ]](/icons/compressed.gif) | Super Mario Time Machine.ext.zip | 2020-09-18 11:53 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Mario The Battle Storm.ext.zip | 2020-09-18 11:53 | 10M | |
![[ ]](/icons/compressed.gif) | Super Mario Sunshine 64 V2.0.ext.zip | 2020-09-18 11:53 | 8.5M | |
![[ ]](/icons/compressed.gif) | Super Mario Star Road Deluxe.ext.zip | 2020-09-18 11:53 | 12M | |
![[ ]](/icons/compressed.gif) | Super Mario Star Road - Multiplayer Version (1.0).zip | 2020-09-18 11:53 | 12M | |
![[ ]](/icons/compressed.gif) | Super Mario StarRevenge 2 (demo).zip | 2020-09-18 11:53 | 9.5M | |
![[ ]](/icons/compressed.gif) | Super Mario StarRevenge 0.5 - Unused Levels [v1.0.1b].ext.zip | 2020-09-18 11:53 | 12M | |
![[ ]](/icons/compressed.gif) | Super Mario Star.zip | 2020-09-18 11:53 | 10M | |
![[ ]](/icons/compressed.gif) | Super Mario Shining Stars 2 - Mirror Madness (Demo).zip | 2020-09-18 11:53 | 10M | |
![[ ]](/icons/compressed.gif) | Super Mario Random Road SMSW c_Editon v1.3.zip | 2020-09-18 11:53 | 9.6M | |
![[ ]](/icons/compressed.gif) | Super Mario Rainbow Road Plus (1.0).ext.zip | 2020-09-18 11:53 | 9.7M | |
![[ ]](/icons/compressed.gif) | Super Mario New Star (EN).zip | 2020-09-18 11:54 | 12M | |
![[ ]](/icons/compressed.gif) | Super Mario Galaxy 64 BETA.zip | 2020-09-18 11:54 | 8.1M | |
![[ ]](/icons/compressed.gif) | Super Mario Galaxy 2 64.ext.zip | 2020-09-18 11:54 | 8.5M | |
![[ ]](/icons/compressed.gif) | Super Mario Falling Stars.zip | 2020-09-18 11:54 | 6.7M | |
![[ ]](/icons/compressed.gif) | Super Mario Fallen Stars.zip | 2020-09-18 11:54 | 9.6M | |
![[ ]](/icons/compressed.gif) | Super Mario Bros 3D.zip | 2020-09-18 11:54 | 11M | |
![[ ]](/icons/compressed.gif) | Super Mario Blast Off! Demo.zip | 2020-09-18 11:54 | 12M | |
![[ ]](/icons/compressed.gif) | Super Mario 128.zip | 2020-09-18 11:54 | 8.7M | |
![[ ]](/icons/compressed.gif) | Super Mario 74 V1.4.ext.zip | 2020-09-18 11:54 | 11M | |
![[ ]](/icons/compressed.gif) | Super Mario 74 - Extreme Edition.ext8.zip | 2020-09-18 11:54 | 11M | |
![[ ]](/icons/compressed.gif) | Super Mario 65 - Happy Birthday of Peach - DEMO (SM64 Hack by Skelenio).zip | 2020-09-18 11:54 | 12M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 and the Colorless Kingdom.ext.zip | 2020-09-18 11:54 | 8.4M | |
![[ ]](/icons/compressed.gif) | Super Mario 64_Mario Dream V1.0.ext.zip | 2020-09-18 11:54 | 8.5M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 StarRevenge - Redone.zip | 2020-09-18 11:54 | 12M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 StarRevenge - Redone (v1.3).zip | 2020-09-18 11:54 | 12M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 StarRevenge - Night of Doom (demo).zip | 2020-09-18 11:54 | 9.6M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 Revenge of the shy guys V2.0 (U) [!].ext.zip | 2020-09-18 11:54 | 8.2M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 Mario's House [v1.0].ext.zip | 2020-09-18 11:54 | 9.1M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 LentiLevels.zip | 2020-09-18 11:54 | 11M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 GP64 (Test) (SM64 Hack by GameProfi64).zip | 2020-09-18 11:54 | 9.3M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 Christmas Land.zip | 2020-09-18 11:54 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 Beta by Dudaw12 [a1].zip | 2020-09-18 11:54 | 8.4M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 BETA1 (U) [!].zip | 2020-09-18 11:54 | 6.1M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 Adventure in Hell.ext.zip | 2020-09-18 11:54 | 8.5M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 1.5 Ztar Attack - C3 DEMO.zip | 2020-09-18 11:54 | 10M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Warp Zone DX (demo 1).zip | 2020-09-18 11:54 | 9.6M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Wacky Worlds v1.0.ext.zip | 2020-09-18 11:54 | 8.7M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Wacky Worlds (v1.1).ext.zip | 2020-09-18 11:54 | 8.5M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Wacky Worlds (2.0).ext.zip | 2020-09-18 11:54 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Twisted Adventures.zip | 2020-09-18 11:54 | 11M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Thwomp's Easter Egg Hunt.zip | 2020-09-18 11:54 | 9.8M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - The Power Star Journey.ext.zip | 2020-09-18 11:54 | 11M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - The Missing Stars.zip | 2020-09-18 11:54 | 9.1M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - The Missing Stars.ext.zip | 2020-09-18 11:54 | 8.9M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - The 10 Lost Stars (v1.0).ext.zip | 2020-09-18 11:54 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Test Worlds.ext.zip | 2020-09-18 11:54 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Superstar Saga [C3 2014 Demo].zip | 2020-09-18 11:54 | 9.3M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Star Road.ext.zip | 2020-09-18 11:54 | 12M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Sky Stories.zip | 2020-09-18 11:54 | 9.4M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Shining Stars (demo).zip | 2020-09-18 11:54 | 9.3M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Return to Retroland.ext.zip | 2020-09-18 11:54 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Peach's Christmas Invitation.zip | 2020-09-18 11:54 | 11M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Organ of Matrias[complete].ext.zip | 2020-09-18 11:54 | 9.5M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Organ of Matrias.zip | 2020-09-18 11:54 | 9.5M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Multiplayer.zip | 2020-09-18 11:54 | 6.0M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Legend of the 70 Power Stars.zip | 2020-09-18 11:54 | 8.7M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Kirby Edition.ext.zip | 2020-09-18 11:54 | 8.4M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - End of Days (U) [!].ext.zip | 2020-09-18 11:54 | 8.7M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Easy Worlds (V1.0) - Chaos Edition (SM64 Hack by Pilzinsel64).zip | 2020-09-18 11:54 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Easy Worlds (V1.0) (SM64 Hack by Pilzinsel64).zip | 2020-09-18 11:54 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Christmas Carnival.ext.zip | 2020-09-18 11:54 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 - Bob-Omb Richard's Master Test.zip | 2020-09-18 11:54 | 9.6M | |
![[ ]](/icons/compressed.gif) | Super Mario 64 (U) [!].zip | 2020-09-18 11:54 | 6.0M | |
![[ ]](/icons/compressed.gif) | Super Mario - The Power Star (Christmas Special).zip | 2020-09-18 11:54 | 9.9M | |
![[ ]](/icons/compressed.gif) | Super Mario - The Halloween Star (SM64 Hack by Fares242).zip | 2020-09-18 11:54 | 9.2M | |
![[ ]](/icons/compressed.gif) | Super Mario - The Battle Storm (SM64 Hack by Fares242).zip | 2020-09-18 11:54 | 10M | |
![[ ]](/icons/compressed.gif) | Super Mario - HD.zip | 2020-09-18 11:54 | 6.0M | |
![[ ]](/icons/compressed.gif) | Super Mario & the missing memories DEMO.zip | 2020-09-18 11:54 | 11M | |
![[ ]](/icons/compressed.gif) | Super Mario & The Big Power Star Hunt.zip | 2020-09-18 11:54 | 9.1M | |
![[ ]](/icons/compressed.gif) | Super Mario & Planet Stardust's Rampage (v2.0).zip | 2020-09-18 11:55 | 12M | |
![[ ]](/icons/compressed.gif) | Super Luigi 64_The Texture Stars.ext.zip | 2020-09-18 11:55 | 8.6M | |
![[ ]](/icons/compressed.gif) | Super Luigi 64.zip | 2020-09-18 11:55 | 8.7M | |
![[ ]](/icons/compressed.gif) | Super Dario 64 final.zip | 2020-09-18 11:55 | 8.5M | |
![[ ]](/icons/compressed.gif) | Super Bowling 64 (U) [!].zip | 2020-09-18 11:55 | 5.0M | |
![[ ]](/icons/compressed.gif) | Super Banjo Tooie 64.zip | 2020-09-18 11:55 | 14M | |
![[ ]](/icons/compressed.gif) | Super Banjo-Kazooie 64 (beta).ext.zip | 2020-09-18 11:55 | 11M | |
![[ ]](/icons/compressed.gif) | Super B-Daman - Battle Phoenix 64 (Japan).zip | 2020-09-18 11:55 | 10M | |
![[ ]](/icons/compressed.gif) | Stunt Racer 64 (U) [!].zip | 2020-09-18 11:55 | 10M | |
![[ ]](/icons/compressed.gif) | Starshot - Space Circus Fever (U) [!].zip | 2020-09-18 11:55 | 11M | |
![[ ]](/icons/compressed.gif) | Star Wars Episode I - Racer (U) [!].zip | 2020-09-18 11:55 | 24M | |
![[ ]](/icons/compressed.gif) | Star Wars Episode I - Battle for Naboo (U) [!].zip | 2020-09-18 11:55 | 26M | |
![[ ]](/icons/compressed.gif) | Star Wars - Shadows of the Empire (U) (V1.2) [!].zip | 2020-09-18 11:55 | 11M | |
![[ ]](/icons/compressed.gif) | Star Wars - Rogue Squadron (U) [!].zip | 2020-09-18 11:55 | 14M | |
![[ ]](/icons/compressed.gif) | Star Soldier - Vanishing Earth (U) [!].zip | 2020-09-18 11:55 | 8.5M | |
![[ ]](/icons/compressed.gif) | Star Revenge Redone v2.0.1.zip | 2020-09-18 11:55 | 13M | |
![[ ]](/icons/compressed.gif) | StarRevenge Night of Doom (E).zip | 2020-09-18 11:55 | 12M | |
![[ ]](/icons/compressed.gif) | Star Revenge 7 Park of Time.zip | 2020-09-18 11:55 | 12M | |
![[ ]](/icons/compressed.gif) | Star Revenge 7.5 Kedowsers Return.zip | 2020-09-18 11:55 | 13M | |
![[ ]](/icons/compressed.gif) | Star Revenge 6.9 - Luigi lost in Time.zip | 2020-09-18 11:55 | 10M | |
![[ ]](/icons/compressed.gif) | Star Revenge 2.5 Remnant of Doom.zip | 2020-09-18 11:55 | 12M | |
![[ ]](/icons/compressed.gif) | Star Fox 64 (U) (V1.1) [!].zip | 2020-09-18 11:55 | 10M | |
![[ ]](/icons/compressed.gif) | StarCraft 64 (U) [!].zip | 2020-09-18 11:55 | 26M | |
![[ ]](/icons/compressed.gif) | Spider-Man (U) [!].zip | 2020-09-18 11:55 | 27M | |
![[ ]](/icons/compressed.gif) | Space Station Silicon Valley (U) [!].zip | 2020-09-18 11:55 | 6.1M | |
![[ ]](/icons/compressed.gif) | Space Invaders (U) [!].zip | 2020-09-18 11:55 | 5.9M | |
![[ ]](/icons/compressed.gif) | South Park Rally (U) [!].zip | 2020-09-18 11:55 | 13M | |
![[ ]](/icons/compressed.gif) | South Park - Chef's Luv Shack (E) [!].zip | 2020-09-18 11:55 | 14M | |
![[ ]](/icons/compressed.gif) | South Park (U) [!].zip | 2020-09-18 11:55 | 13M | |
![[ ]](/icons/compressed.gif) | Sonic the Hedgehog in Zelda - Ocarina of Time.zip | 2020-09-18 11:55 | 31M | |
![[ ]](/icons/compressed.gif) | Sonic the Hedgehog 64.ext.zip | 2020-09-18 11:55 | 8.4M | |
![[ ]](/icons/compressed.gif) | Sonic Adventure 64 [C3 Demo].zip | 2020-09-18 11:55 | 9.5M | |
![[ ]](/icons/compressed.gif) | Snowboard Kids 2 (U) [!].zip | 2020-09-18 11:55 | 11M | |
![[ ]](/icons/compressed.gif) | Snowboard Kids (U) [!].zip | 2020-09-18 11:55 | 4.6M | |
![[ ]](/icons/compressed.gif) | Sin and Punishment.zip | 2020-09-18 11:55 | 24M | |
![[ ]](/icons/compressed.gif) | Sim City 2000 (Japan).zip | 2020-09-18 11:55 | 4.8M | |
![[ ]](/icons/compressed.gif) | Shin Nihon Pro Wrestling Toukon Road 2 - The Next Generation (Japan).zip | 2020-09-18 11:55 | 22M | |
![[ ]](/icons/compressed.gif) | Shin Nihon Pro Wrestling Toukon Road - Brave Spirits (Japan).zip | 2020-09-18 11:55 | 6.2M | |
![[ ]](/icons/compressed.gif) | Shadowgate 64 - Trials of the Four Towers (U) [!].zip | 2020-09-18 11:55 | 13M | |
![[ ]](/icons/compressed.gif) | Shadow Man (U) [!].zip | 2020-09-18 11:56 | 29M | |
![[ ]](/icons/compressed.gif) | Seaside Town.zip | 2020-09-18 11:55 | 9.3M | |
![[ ]](/icons/compressed.gif) | Scrooge 64.zip | 2020-09-18 11:55 | 9.5M | |
![[ ]](/icons/compressed.gif) | Scooby-Doo! - Classic Creep Capers (U) [!].zip | 2020-09-18 11:55 | 9.8M | |
![[ ]](/icons/compressed.gif) | San Francisco Rush 2049 (U) [!].zip | 2020-09-18 11:55 | 11M | |
![[ ]](/icons/compressed.gif) | San Francisco Rush - Extreme Racing (U) [!].zip | 2020-09-18 11:55 | 7.6M | |
![[ ]](/icons/compressed.gif) | Saikyou Habu Shougi (Japan).zip | 2020-09-18 11:56 | 6.0M | |
![[ ]](/icons/compressed.gif) | SS3SotSCdemo1.zip | 2020-09-18 11:56 | 9.8M | |
![[ ]](/icons/compressed.gif) | SPECIAL FOR YOU.zip | 2020-09-18 11:56 | 9.2M | |
![[ ]](/icons/compressed.gif) | SMSR Multiplayer 1.1.zip | 2020-09-18 11:56 | 12M | |
![[ ]](/icons/compressed.gif) | SMRR.zip | 2020-09-18 11:56 | 9.4M | |
![[ ]](/icons/compressed.gif) | SM64 Year of the Plumber c3 demo.ext.zip | 2020-09-18 11:56 | 9.6M | |
![[ ]](/icons/compressed.gif) | SM64 The Wonderous Worlds.zip | 2020-09-18 11:56 | 9.5M | |
![[ ]](/icons/compressed.gif) | SM64 The Green Stars [v1.2].zip | 2020-09-18 11:56 | 11M | |
![[ ]](/icons/compressed.gif) | SM64 The Green Stars (v2.0).zip | 2020-09-18 11:56 | 11M | |
![[ ]](/icons/compressed.gif) | SM64TA Intense.zip | 2020-09-18 11:56 | 9.4M | |
![[ ]](/icons/compressed.gif) | SM64 StarRevenge6.5 - Wrath of the Dim. Flower (SM64 Hack by BroDute).zip | 2020-09-18 11:56 | 13M | |
![[ ]](/icons/compressed.gif) | SM64 StarRevenge.zip | 2020-09-18 11:56 | 11M | |
![[ ]](/icons/compressed.gif) | SM64 Shining Stars 2 Mirror Madness.zip | 2020-09-18 11:56 | 12M | |
![[ ]](/icons/compressed.gif) | SM64 Shining Star Final 4.0s.zip | 2020-09-18 11:56 | 11M | |
![[ ]](/icons/compressed.gif) | SM64RainbowRoad.ext.zip | 2020-09-18 11:56 | 9.7M | |
![[ ]](/icons/compressed.gif) | SM64 New Generation v.0.1.0 (ENG).zip | 2020-09-18 11:56 | 9.3M | |
![[ ]](/icons/compressed.gif) | SM64 Multiplayer 1.3.zip | 2020-09-18 11:56 | 6.1M | |
![[ ]](/icons/compressed.gif) | SM64 Multiplayer 1.2.zip | 2020-09-18 11:56 | 6.0M | |
![[ ]](/icons/compressed.gif) | SM 64 MADNESS.zip | 2020-09-18 11:56 | 9.8M | |
![[ ]](/icons/compressed.gif) | SM64 Halloween Mayhem (SM64 Hack by Kinopio).zip | 2020-09-18 11:56 | 10M | |
![[ ]](/icons/compressed.gif) | SM64 Grand Star Demo 1.zip | 2020-09-18 11:56 | 9.4M | |
![[ ]](/icons/compressed.gif) | SM 64 Extreme Edition.zip | 2020-09-18 11:56 | 9.2M | |
![[ ]](/icons/compressed.gif) | SM64 Christmas 2012.zip | 2020-09-18 11:56 | 9.3M | |
![[ ]](/icons/compressed.gif) | SM64 Chill Dein Leben (Deu) [T-Eng] (SM64 Hack by Blackshadowdrybones).zip | 2020-09-18 11:56 | 9.8M | |
![[ ]](/icons/compressed.gif) | SM64 Chaos Edition V1.1.zip | 2020-09-18 11:56 | 5.9M | |
![[ ]](/icons/compressed.gif) | SM64 C3 Boonsters Peril.zip | 2020-09-18 11:56 | 10M | |
![[ ]](/icons/compressed.gif) | SM64 BT Demo 1.0.zip | 2020-09-18 11:56 | 9.4M | |
![[ ]](/icons/compressed.gif) | SM64ANewAdventureBetaLevels.zip | 2020-09-18 11:56 | 10M | |
![[ ]](/icons/compressed.gif) | SM64 - The Final Star 2 (v1.1).zip | 2020-09-18 11:56 | 9.6M | |
![[ ]](/icons/compressed.gif) | SM64 - The Final Star.zip | 2020-09-18 11:56 | 9.3M | |
![[ ]](/icons/compressed.gif) | SM64-SR6-Luigis Adventure.zip | 2020-09-18 11:56 | 12M | |
![[ ]](/icons/compressed.gif) | SM64 - All or Nothing.zip | 2020-09-18 11:56 | 9.6M | |
![[ ]](/icons/compressed.gif) | SL64 Super Luigi 64.zip | 2020-09-18 11:56 | 9.5M | |
![[ ]](/icons/compressed.gif) | SL64 Multiplayer.zip | 2020-09-18 11:56 | 9.5M | |
![[ ]](/icons/compressed.gif) | SD Hiryuu no Ken Densetsu (Japan).zip | 2020-09-18 11:56 | 8.6M | |
![[ ]](/icons/compressed.gif) | S.C.A.R.S. (U) [!].zip | 2020-09-18 11:56 | 3.6M | |
![[ ]](/icons/compressed.gif) | Rush 2 - Extreme Racing USA (U) [!].zip | 2020-09-18 11:56 | 11M | |
![[ ]](/icons/compressed.gif) | Rugrats in Paris - The Movie (U) [!].zip | 2020-09-18 11:56 | 11M | |
![[ ]](/icons/compressed.gif) | Rugrats - Scavenger Hunt (U) [!].zip | 2020-09-18 11:56 | 12M | |
![[ ]](/icons/compressed.gif) | Ronaldinho Soccer 64 (Brazil) (Pirate) - CARROT.zip | 2020-09-18 11:56 | 6.2M | |
![[ ]](/icons/compressed.gif) | Rocket - Robot on Wheels (U) [!].zip | 2020-09-18 11:56 | 8.0M | |
![[ ]](/icons/compressed.gif) | Robotron 64 (U) [!].zip | 2020-09-18 11:56 | 2.3M | |
![[ ]](/icons/compressed.gif) | Robotech - Crystal Dreams (USA) (Proto).zip | 2020-09-18 11:56 | 7.4M | |
![[ ]](/icons/compressed.gif) | Robot Ponkottsu 64 - 7tsu no Umi no Caramel (Japan).zip | 2020-09-18 11:56 | 11M | |
![[ ]](/icons/compressed.gif) | Roadsters Trophy (U) [!].zip | 2020-09-18 11:56 | 8.6M | |
![[ ]](/icons/compressed.gif) | Road Rash 64 (U) [!].zip | 2020-09-18 11:56 | 18M | |
![[ ]](/icons/compressed.gif) | Resident Evil 2 (U) (V1.1) [!].zip | 2020-09-18 11:57 | 62M | |
![[ ]](/icons/compressed.gif) | Ready 2 Rumble Boxing - Round 2 (U) [!].zip | 2020-09-18 11:57 | 27M | |
![[ ]](/icons/compressed.gif) | Ready 2 Rumble Boxing (U) [!].zip | 2020-09-18 11:57 | 29M | |
![[ ]](/icons/compressed.gif) | Re-Volt (U) [!].zip | 2020-09-18 11:56 | 9.9M | |
![[ ]](/icons/compressed.gif) | Razor Freestyle Scooter (U) [!].zip | 2020-09-18 11:56 | 6.9M | |
![[ ]](/icons/compressed.gif) | Razmoket, Les - La Chasse aux Tresors (France).zip | 2020-09-18 11:56 | 13M | |
![[ ]](/icons/compressed.gif) | Rayman 2 - The Great Escape (U) (M5) [!].zip | 2020-09-18 11:57 | 18M | |
![[ ]](/icons/compressed.gif) | Rat Attack (U) (M6) [!].zip | 2020-09-18 11:57 | 4.6M | |
![[ ]](/icons/compressed.gif) | Rampage 2 - Universal Tour (U) [!].zip | 2020-09-18 11:57 | 10M | |
![[ ]](/icons/compressed.gif) | Rampage - World Tour (U) [!].zip | 2020-09-18 11:57 | 9.9M | |
![[ ]](/icons/compressed.gif) | Rally Challenge 2000 (U) [!].zip | 2020-09-18 11:57 | 9.4M | |
![[ ]](/icons/compressed.gif) | Rakuga Kids (Europe).zip | 2020-09-18 11:57 | 11M | |
![[ ]](/icons/compressed.gif) | RR64 - Ridge Racer 64 (U) [!].zip | 2020-09-18 11:57 | 18M | |
![[ ]](/icons/compressed.gif) | Quest 64 (U) [!].zip | 2020-09-18 11:57 | 6.7M | |
![[ ]](/icons/compressed.gif) | Quake II (U) [!].zip | 2020-09-18 11:57 | 11M | |
![[ ]](/icons/compressed.gif) | Quake 64 (U) [!].zip | 2020-09-18 11:57 | 11M | |
![[ ]](/icons/compressed.gif) | Puyo Puyo Sun 64 (Japan).zip | 2020-09-18 11:57 | 6.0M | |
![[ ]](/icons/compressed.gif) | Puyo Puyo 4 - Puyo Puyon Party (J) [!].zip | 2020-09-18 11:57 | 8.7M | |
![[ ]](/icons/compressed.gif) | Pro Mahjong Tsuwamono 64 - Jansou Battle ni Chousen (Japan).zip | 2020-09-18 11:57 | 3.6M | |
![[ ]](/icons/compressed.gif) | Pro Mahjong Kiwame 64 (Japan).zip | 2020-09-18 11:57 | 3.9M | |
![[ ]](/icons/compressed.gif) | Premier Manager 64 (Europe).zip | 2020-09-18 11:57 | 11M | |
![[ ]](/icons/compressed.gif) | Powerpuff Girls, The - Chemical X-Traction (U) [!].zip | 2020-09-18 11:57 | 3.7M | |
![[ ]](/icons/compressed.gif) | Power Rangers - Lightspeed Rescue (U) [!].zip | 2020-09-18 11:57 | 9.4M | |
![[ ]](/icons/compressed.gif) | Power League 64 (Japan).zip | 2020-09-18 11:57 | 6.0M | |
![[ ]](/icons/compressed.gif) | Polaris SnoCross (U) [!].zip | 2020-09-18 11:57 | 8.4M | |
![[ ]](/icons/compressed.gif) | Pokemon Stadium 2 (U) [!].zip | 2020-09-18 11:57 | 47M | |
![[ ]](/icons/compressed.gif) | Pokemon Stadium - Kiosk (U) (V1.1) [!].zip | 2020-09-18 11:57 | 26M | |
![[ ]](/icons/compressed.gif) | Pokemon Stadium (U) [!].zip | 2020-09-18 11:57 | 26M | |
![[ ]](/icons/compressed.gif) | Pokemon Snap Station (USA) (Promo).zip | 2020-09-18 11:57 | 8.8M | |
![[ ]](/icons/compressed.gif) | Pokemon Snap Station (U) [!].zip | 2020-09-18 11:57 | 8.7M | |
![[ ]](/icons/compressed.gif) | Pokemon Snap (U) [!].zip | 2020-09-18 11:57 | 8.7M | |
![[ ]](/icons/compressed.gif) | Pokemon Puzzle League (U) [!].zip | 2020-09-18 11:57 | 22M | |
![[ ]](/icons/compressed.gif) | Pocket Monsters Stadium (J) [!].zip | 2020-09-18 11:57 | 13M | |
![[ ]](/icons/compressed.gif) | Pilotwings 64 (U) [!].zip | 2020-09-18 11:57 | 4.9M | |
![[ ]](/icons/compressed.gif) | Pidi64s Adventures 64 - A Slippery Day (V1.0).zip | 2020-09-18 11:57 | 11M | |
![[ ]](/icons/compressed.gif) | Perfect Dark (U) (V1.1) [!].zip | 2020-09-18 11:57 | 29M | |
![[ ]](/icons/compressed.gif) | Penny Racers (U) [!].zip | 2020-09-18 11:57 | 2.4M | |
![[ ]](/icons/compressed.gif) | Parlor! Pro 64 - Pachinko Jikki Simulation Game (Japan).zip | 2020-09-18 11:57 | 7.3M | |
![[ ]](/icons/compressed.gif) | Paperboy (U) [!].zip | 2020-09-18 11:57 | 6.5M | |
![[ ]](/icons/compressed.gif) | Paper Mario (U) [!].zip | 2020-09-18 11:57 | 22M | |
![[ ]](/icons/compressed.gif) | Paper Mario (E) (M4) [!].zip | 2020-09-18 11:57 | 32M | |
![[ ]](/icons/compressed.gif) | Pachinko 365 Nichi (Japan).zip | 2020-09-18 11:57 | 8.6M | |
![[ ]](/icons/compressed.gif) | PGA European Tour (E) (M5) [!].zip | 2020-09-18 11:57 | 13M | |
![[ ]](/icons/compressed.gif) | PD Ultraman Battle Collection 64 (Japan).zip | 2020-09-18 11:57 | 18M | |
![[ ]](/icons/compressed.gif) | Operation WinBack (Europe) (En,Fr,De,Es,It).zip | 2020-09-18 11:57 | 11M | |
![[ ]](/icons/compressed.gif) | Onegai Monsters (Japan).zip | 2020-09-18 11:57 | 13M | |
![[ ]](/icons/compressed.gif) | Olympic Hockey Nagano '98 (U) [!].zip | 2020-09-18 11:57 | 5.6M | |
![[ ]](/icons/compressed.gif) | Ogre Battle 64 - Person of Lordly Caliber (U) [!].zip | 2020-09-18 11:58 | 34M | |
![[ ]](/icons/compressed.gif) | Off Road Challenge (U) [!].zip | 2020-09-18 11:58 | 7.6M | |
![[ ]](/icons/compressed.gif) | O.D.T. (U) (M3) [!].zip | 2020-09-18 11:58 | 13M | |
![[ ]](/icons/compressed.gif) | Nushi Zuri 64 - Shiokaze ni Notte (Japan).zip | 2020-09-18 11:58 | 16M | |
![[ ]](/icons/compressed.gif) | Nushi Zuri 64 (Japan).zip | 2020-09-18 11:58 | 11M | |
![[ ]](/icons/compressed.gif) | Nuclear Strike 64 (U) [!].zip | 2020-09-18 11:58 | 17M | |
![[ ]](/icons/compressed.gif) | Nintama Rantarou 64 Game Gallery (Japan).zip | 2020-09-18 11:58 | 3.0M | |
![[ ]](/icons/compressed.gif) | Nightmare Creatures (U) [!].zip | 2020-09-18 11:58 | 11M | |
![[ ]](/icons/compressed.gif) | New Tetris, The (U) [!].zip | 2020-09-18 11:58 | 9.8M | |
![[ ]](/icons/compressed.gif) | Neon Genesis Evangelion (Japan).zip | 2020-09-18 11:58 | 24M | |
![[ ]](/icons/compressed.gif) | Namco Museum 64 (U) [!].zip | 2020-09-18 11:58 | 2.9M | |
![[ ]](/icons/compressed.gif) | Nagano Winter Olympics '98 (U) [!].zip | 2020-09-18 11:58 | 9.4M | |
![[ ]](/icons/compressed.gif) | NHL Breakaway 99 (U) [!].zip | 2020-09-18 11:58 | 9.4M | |
![[ ]](/icons/compressed.gif) | NHL Breakaway 98 (U) [!].zip | 2020-09-18 11:58 | 11M | |
![[ ]](/icons/compressed.gif) | NHL Blades of Steel '99 (U) [!].zip | 2020-09-18 11:58 | 8.9M | |
![[ ]](/icons/compressed.gif) | NHL 99 (U) [!].zip | 2020-09-18 11:58 | 11M | |
![[ ]](/icons/compressed.gif) | NFL Quarterback Club 2001 (U) [!].zip | 2020-09-18 11:58 | 10M | |
![[ ]](/icons/compressed.gif) | NFL Quarterback Club 2000 (U) [!].zip | 2020-09-18 11:58 | 11M | |
![[ ]](/icons/compressed.gif) | NFL Quarterback Club 99 (U) [!].zip | 2020-09-18 11:58 | 11M | |
![[ ]](/icons/compressed.gif) | NFL Quarterback Club 98 (U) [!].zip | 2020-09-18 11:58 | 7.5M | |
![[ ]](/icons/compressed.gif) | NFL Blitz 2001 (U) [!].zip | 2020-09-18 11:58 | 14M | |
![[ ]](/icons/compressed.gif) | NFL Blitz 2000 (U) [!].zip | 2020-09-18 11:58 | 14M | |
![[ ]](/icons/compressed.gif) | NFL Blitz - Special Edition (U) [!].zip | 2020-09-18 11:58 | 14M | |
![[ ]](/icons/compressed.gif) | NFL Blitz (U) [!].zip | 2020-09-18 11:58 | 13M | |
![[ ]](/icons/compressed.gif) | NBA Showtime - NBA on NBC (U) [!].zip | 2020-09-18 11:58 | 14M | |
![[ ]](/icons/compressed.gif) | NBA Live 2000 (U) [!].zip | 2020-09-18 11:58 | 12M | |
![[ ]](/icons/compressed.gif) | NBA Live 99 (U) [!].zip | 2020-09-18 11:58 | 12M | |
![[ ]](/icons/compressed.gif) | NBA Jam 2000 (U) [!].zip | 2020-09-18 11:58 | 14M | |
![[ ]](/icons/compressed.gif) | NBA Jam 99 (U) [!].zip | 2020-09-18 11:58 | 11M | |
![[ ]](/icons/compressed.gif) | NBA In the Zone 2000 (U) [!].zip | 2020-09-18 11:58 | 13M | |
![[ ]](/icons/compressed.gif) | NBA In the Zone '99 (U) [!].zip | 2020-09-18 11:58 | 9.9M | |
![[ ]](/icons/compressed.gif) | NBA In the Zone '98 (U) [!].zip | 2020-09-18 11:58 | 9.5M | |
![[ ]](/icons/compressed.gif) | NBA Hangtime (U) [!].zip | 2020-09-18 11:58 | 10M | |
![[ ]](/icons/compressed.gif) | NBA Courtside 2 - Featuring Kobe Bryant (U) [!].zip | 2020-09-18 11:58 | 14M | |
![[ ]](/icons/compressed.gif) | NASCAR 2000 (U) [!].zip | 2020-09-18 11:58 | 9.2M | |
![[ ]](/icons/compressed.gif) | NASCAR 99 (U) [!].zip | 2020-09-18 11:58 | 9.8M | |
![[ ]](/icons/compressed.gif) | Mystical Ninja Starring Goemon (U) [!].zip | 2020-09-18 11:58 | 13M | |
![[ ]](/icons/compressed.gif) | Ms. Pac-Man - Maze Madness (U) [!].zip | 2020-09-18 11:58 | 9.9M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat Trilogy (U) (V1.2) [!].zip | 2020-09-18 11:58 | 10M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat Trilogy (E) [!].zip | 2020-09-18 11:58 | 10M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat Mythologies - Sub-Zero (U) [!].zip | 2020-09-18 11:58 | 13M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat 4 (U) [!].zip | 2020-09-18 11:58 | 13M | |
![[ ]](/icons/compressed.gif) | Monster Truck Madness 64 (U) [!].zip | 2020-09-18 11:58 | 6.7M | |
![[ ]](/icons/compressed.gif) | Monopoly (U) [!].zip | 2020-09-18 11:58 | 2.7M | |
![[ ]](/icons/compressed.gif) | Monochrome Mario 64.ext.zip | 2020-09-18 11:58 | 9.3M | |
![[ ]](/icons/compressed.gif) | Monaco Grand Prix (U) [!].zip | 2020-09-18 11:59 | 14M | |
![[ ]](/icons/compressed.gif) | Mission Impossible (U) [!].zip | 2020-09-18 11:58 | 11M | |
![[ ]](/icons/compressed.gif) | Mischief Makers (U) [!].zip | 2020-09-18 11:58 | 5.7M | |
![[ ]](/icons/compressed.gif) | Mini Racers (Unreleased) - CARROT.zip | 2020-09-18 11:58 | 4.7M | |
![[ ]](/icons/compressed.gif) | Milo's Astro Lanes (U) [!].zip | 2020-09-18 11:58 | 6.5M | |
![[ ]](/icons/compressed.gif) | Mike Piazza's Strike Zone (U) [!].zip | 2020-09-18 11:58 | 5.1M | |
![[ ]](/icons/compressed.gif) | Midway's Greatest Arcade Hits Volume 1 (U) [!].zip | 2020-09-18 11:58 | 1.8M | |
![[ ]](/icons/compressed.gif) | Micro Machines 64 Turbo (U) [!].zip | 2020-09-18 11:58 | 5.6M | |
![[ ]](/icons/compressed.gif) | Mickey's Speedway USA (U) [!].zip | 2020-09-18 11:59 | 22M | |
![[ ]](/icons/compressed.gif) | Michael Owens WLS 2000 (E) [f1] (NTSC).zip | 2020-09-18 11:59 | 12M | |
![[ ]](/icons/compressed.gif) | Mia Hamm Soccer 64 (U) (M2) [!].zip | 2020-09-18 11:59 | 12M | |
![[ ]](/icons/compressed.gif) | Megaman 64 (Proto).zip | 2020-09-18 11:59 | 51M | |
![[ ]](/icons/compressed.gif) | Mega Man 64 (U) [!].zip | 2020-09-18 11:59 | 27M | |
![[ ]](/icons/compressed.gif) | Marios Future - Demo.zip | 2020-09-18 11:59 | 9.5M | |
![[ ]](/icons/compressed.gif) | Mario on An Saoire 64.zip | 2020-09-18 11:59 | 11M | |
![[ ]](/icons/compressed.gif) | Mario no Photopie (Japan).zip | 2020-09-18 11:59 | 12M | |
![[ ]](/icons/compressed.gif) | Mario and the Magic Wand (demo).zip | 2020-09-18 11:59 | 9.8M | |
![[ ]](/icons/compressed.gif) | Mario Tennis (U) [!].zip | 2020-09-18 11:59 | 14M | |
![[ ]](/icons/compressed.gif) | Mario Party 3 (U) [!].zip | 2020-09-18 11:59 | 24M | |
![[ ]](/icons/compressed.gif) | Mario Party 2 (U) [!].zip | 2020-09-18 11:59 | 24M | |
![[ ]](/icons/compressed.gif) | Mario Party (U) [!].zip | 2020-09-18 11:59 | 21M | |
![[ ]](/icons/compressed.gif) | Mario Kart 64 (U) [!].zip | 2020-09-18 11:59 | 8.6M | |
![[ ]](/icons/compressed.gif) | Mario Golf (U) [!].zip | 2020-09-18 11:59 | 17M | |
![[ ]](/icons/compressed.gif) | Mario Christmas 64.zip | 2020-09-18 11:59 | 9.4M | |
![[ ]](/icons/compressed.gif) | Mario's Nightmare 64.ext.zip | 2020-09-18 11:59 | 11M | |
![[ ]](/icons/compressed.gif) | Mario's Nightmare 64 (v1.1).zip | 2020-09-18 11:59 | 11M | |
![[ ]](/icons/compressed.gif) | Mario's Lonely Holidays 64.zip | 2020-09-18 11:59 | 9.7M | |
![[ ]](/icons/compressed.gif) | Major League Baseball Featuring Ken Griffey Jr. (U) [!].zip | 2020-09-18 11:59 | 13M | |
![[ ]](/icons/compressed.gif) | Mahjong Master (Japan).zip | 2020-09-18 11:59 | 6.1M | |
![[ ]](/icons/compressed.gif) | Mahjong Hourouki Classic (Japan).zip | 2020-09-18 11:59 | 4.7M | |
![[ ]](/icons/compressed.gif) | Mahjong 64 (Japan).zip | 2020-09-18 11:59 | 6.2M | |
![[ ]](/icons/compressed.gif) | Magical Tetris Challenge featuring Mickey (Japan).zip | 2020-09-18 11:59 | 11M | |
![[ ]](/icons/compressed.gif) | Magical Tetris Challenge (U) [!].zip | 2020-09-18 11:59 | 11M | |
![[ ]](/icons/compressed.gif) | Madden NFL 2002 (U) [!].zip | 2020-09-18 11:59 | 10M | |
![[ ]](/icons/compressed.gif) | Madden NFL 2001 (U) [!].zip | 2020-09-18 11:59 | 11M | |
![[ ]](/icons/compressed.gif) | Madden NFL 2000 (U) [!].zip | 2020-09-18 11:59 | 11M | |
![[ ]](/icons/compressed.gif) | Madden NFL 99 (U) [!].zip | 2020-09-18 11:59 | 10M | |
![[ ]](/icons/compressed.gif) | Madden Football 64 (U) [!].zip | 2020-09-18 11:59 | 11M | |
![[ ]](/icons/compressed.gif) | Mace - The Dark Age (U) [!].zip | 2020-09-18 11:59 | 10M | |
![[ ]](/icons/compressed.gif) | MRC - Multi Racing Championship (U) [!].zip | 2020-09-18 11:59 | 8.3M | |
![[ ]](/icons/compressed.gif) | Luigis Mansion 64.zip | 2020-09-18 11:59 | 8.7M | |
![[ ]](/icons/compressed.gif) | Luigi and the Forest Ruins - Multiplayer Edition (SM64 Hack by TheGael95).zip | 2020-09-18 11:59 | 10M | |
![[ ]](/icons/compressed.gif) | Luigi and the Forest Ruins (Revision 1) (SM64 Hack by TheGael95).zip | 2020-09-18 11:59 | 10M | |
![[ ]](/icons/compressed.gif) | Luigi's Mansion 64 (alpha).ext.zip | 2020-09-18 11:59 | 8.9M | |
![[ ]](/icons/compressed.gif) | Lode Runner 3-D (U) [!].zip | 2020-09-18 11:59 | 6.5M | |
![[ ]](/icons/compressed.gif) | Let's Smash (Japan).zip | 2020-09-18 11:59 | 8.3M | |
![[ ]](/icons/compressed.gif) | Legend of Zelda, The - Ocarina of Time - Master Quest (USA) (Debug Edition).zip | 2020-09-18 12:00 | 31M | |
![[ ]](/icons/compressed.gif) | Legend of Zelda, The - Ocarina of Time - Master Quest (E) [!].zip | 2020-09-18 12:00 | 25M | |
![[ ]](/icons/compressed.gif) | Legend of Zelda, The - Ocarina of Time (U) (V1.2) [!].zip | 2020-09-18 12:00 | 25M | |
![[ ]](/icons/compressed.gif) | Legend of Zelda, The - Majoras Mask (Debug Edition).zip | 2020-09-18 12:00 | 34M | |
![[ ]](/icons/compressed.gif) | Legend of Zelda, The - Majora's Mask (U) [!].zip | 2020-09-18 12:00 | 26M | |
![[ ]](/icons/compressed.gif) | Legend of Zelda, The - Majora's Mask (U) (GC Version).zip | 2020-09-18 12:00 | 26M | |
![[ ]](/icons/compressed.gif) | Legend of Zelda, The - Majora's Mask (E) (M4) (V1.0) [!].zip | 2020-09-18 12:00 | 27M | |
![[ ]](/icons/compressed.gif) | Last Legion UX (Japan).zip | 2020-09-18 12:00 | 7.2M | |
![[ ]](/icons/compressed.gif) | LIGHT or DARK (V1.0) (Super Mario 64 Hack).zip | 2020-09-18 12:00 | 11M | |
![[ ]](/icons/compressed.gif) | LEGO Racers (U) [!].zip | 2020-09-18 12:00 | 10M | |
![[ ]](/icons/compressed.gif) | Kobe Bryant's NBA Courtside (U) [!].zip | 2020-09-18 12:00 | 11M | |
![[ ]](/icons/compressed.gif) | Knockout Kings 2000 (U) [!].zip | 2020-09-18 12:00 | 13M | |
![[ ]](/icons/compressed.gif) | Knife Edge - Nose Gunner (U) [!].zip | 2020-09-18 12:00 | 4.7M | |
![[ ]](/icons/compressed.gif) | Kirby 64 - The Crystal Shards (U) [!].zip | 2020-09-18 12:00 | 12M | |
![[ ]](/icons/compressed.gif) | Kiratto Kaiketsu! 64 Tanteidan (Japan).zip | 2020-09-18 12:00 | 6.3M | |
![[ ]](/icons/compressed.gif) | Killer Instinct Gold (U) (V1.2) [!].zip | 2020-09-18 12:00 | 12M | |
![[ ]](/icons/compressed.gif) | Ken Griffey Jr.'s Slugfest (U) [!].zip | 2020-09-18 12:00 | 13M | |
![[ ]](/icons/compressed.gif) | Kazes Warmup.zip | 2020-09-18 12:00 | 10M | |
![[ ]](/icons/compressed.gif) | Kaizo Mario 64.zip | 2020-09-18 12:00 | 8.7M | |
![[ ]](/icons/compressed.gif) | John Romero's Daikatana (U) [!].zip | 2020-09-18 12:00 | 13M | |
![[ ]](/icons/compressed.gif) | Jinsei Game 64 (Japan).zip | 2020-09-18 12:00 | 6.7M | |
![[ ]](/icons/compressed.gif) | Jikkyou Powerful Pro Yakyuu Basic Ban 2001 (Japan).zip | 2020-09-18 12:00 | 13M | |
![[ ]](/icons/compressed.gif) | Jikkyou Powerful Pro Yakyuu 2000 (Japan).zip | 2020-09-18 12:00 | 13M | |
![[ ]](/icons/compressed.gif) | Jikkyou Powerful Pro Yakyuu 6 (Japan).zip | 2020-09-18 12:00 | 13M | |
![[ ]](/icons/compressed.gif) | Jikkyou Powerful Pro Yakyuu 5 (Japan).zip | 2020-09-18 12:00 | 12M | |
![[ ]](/icons/compressed.gif) | Jikkyou Powerful Pro Yakyuu 4 (Japan).zip | 2020-09-18 12:00 | 9.5M | |
![[ ]](/icons/compressed.gif) | Jikkyou J.League Perfect Striker (J) [!].zip | 2020-09-18 12:00 | 6.2M | |
![[ ]](/icons/compressed.gif) | Jikkyou G1 Stable (Japan).zip | 2020-09-18 12:00 | 11M | |
![[ ]](/icons/compressed.gif) | Jet Force Gemini (U) [!].zip | 2020-09-18 12:00 | 28M | |
![[ ]](/icons/compressed.gif) | Jeremy McGrath Supercross 2000 (U) [!].zip | 2020-09-18 12:00 | 13M | |
![[ ]](/icons/compressed.gif) | Jeopardy! (U) [!].zip | 2020-09-18 12:00 | 2.1M | |
![[ ]](/icons/compressed.gif) | Jangou Simulation Mahjong Dou 64 (Japan).zip | 2020-09-18 12:00 | 3.6M | |
![[ ]](/icons/compressed.gif) | J.League Tactics Soccer (Japan).zip | 2020-09-18 12:00 | 6.1M | |
![[ ]](/icons/compressed.gif) | J.League Live 64 (Japan).zip | 2020-09-18 12:00 | 4.8M | |
![[ ]](/icons/compressed.gif) | J.League Eleven Beat 1997 (Japan).zip | 2020-09-18 12:00 | 6.0M | |
![[ ]](/icons/compressed.gif) | J.League Dynamite Soccer 64 (Japan).zip | 2020-09-18 12:00 | 3.8M | |
![[ ]](/icons/compressed.gif) | Itoi Shigesato no Bass Tsuri No. 1 Kettei Ban! (Japan).zip | 2020-09-18 12:00 | 9.5M | |
![[ ]](/icons/compressed.gif) | It's A Crash.zip | 2020-09-18 12:00 | 9.5M | |
![[ ]](/icons/compressed.gif) | International Track & Field 2000 (U) [!].zip | 2020-09-18 12:00 | 8.8M | |
![[ ]](/icons/compressed.gif) | International Superstar Soccer 2000 (U) [!].zip | 2020-09-18 12:00 | 11M | |
![[ ]](/icons/compressed.gif) | International Superstar Soccer 64 (U) [!].zip | 2020-09-18 12:00 | 6.2M | |
![[ ]](/icons/compressed.gif) | International Superstar Soccer '98 (U) [!].zip | 2020-09-18 12:00 | 8.9M | |
![[ ]](/icons/compressed.gif) | Indy Racing 2000 (U) [!].zip | 2020-09-18 12:00 | 10M | |
![[ ]](/icons/compressed.gif) | Indiana Jones and the Infernal Machine (U) [!].zip | 2020-09-18 12:01 | 26M | |
![[ ]](/icons/compressed.gif) | In-Fisherman Bass Hunter 64 (U) [!].zip | 2020-09-18 12:00 | 2.9M | |
![[ ]](/icons/compressed.gif) | Iggy's Reckin' Balls (U) [!].zip | 2020-09-18 12:01 | 7.4M | |
![[ ]](/icons/compressed.gif) | Ide Yosuke no Mahjong Juku (Japan).zip | 2020-09-18 12:00 | 4.2M | |
![[ ]](/icons/compressed.gif) | Hydro Thunder (U) [!].zip | 2020-09-18 12:01 | 19M | |
![[ ]](/icons/compressed.gif) | Hydro Thunder (E) [f1] (NTSC).zip | 2020-09-18 12:01 | 19M | |
![[ ]](/icons/compressed.gif) | Hybrid Heaven (U) [!].zip | 2020-09-18 12:01 | 11M | |
![[ ]](/icons/compressed.gif) | Hot Wheels Turbo Racing (U) [!].zip | 2020-09-18 12:01 | 11M | |
![[ ]](/icons/compressed.gif) | Hey You, Pikachu! (U) [!].zip | 2020-09-18 12:01 | 8.5M | |
![[ ]](/icons/compressed.gif) | Hexen (U) [!].zip | 2020-09-18 12:01 | 7.5M | |
![[ ]](/icons/compressed.gif) | Hercules - The Legendary Journeys (U) [o1].zip | 2020-09-18 12:01 | 15M | |
![[ ]](/icons/compressed.gif) | Hercules - The Legendary Journeys (E) (M6) [!].zip | 2020-09-18 12:01 | 14M | |
![[ ]](/icons/compressed.gif) | Heiwa Pachinko World 64 (Japan).zip | 2020-09-18 12:01 | 4.4M | |
![[ ]](/icons/compressed.gif) | Harvest Moon 64 (U) [!].zip | 2020-09-18 12:01 | 6.2M | |
![[ ]](/icons/compressed.gif) | Harukanaru Augusta - Masters '98 (Japan).zip | 2020-09-18 12:01 | 13M | |
![[ ]](/icons/compressed.gif) | Hamster Monogatari 64 (Japan).zip | 2020-09-18 12:01 | 6.6M | |
![[ ]](/icons/compressed.gif) | Hallowoomy 64.zip | 2020-09-18 12:01 | 9.4M | |
![[ ]](/icons/compressed.gif) | Goombas Easter Egg Hunt - Easter Special! (SM64 Hack by Kaze).zip | 2020-09-18 12:01 | 9.8M | |
![[ ]](/icons/compressed.gif) | Goldeneye Multiplayer Level - Peach's Castle.rom.zip | 2020-09-18 12:01 | 11M | |
![[ ]](/icons/compressed.gif) | Golden Nugget 64 (U) [!].zip | 2020-09-18 12:01 | 5.7M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - Zoinkitty's Map Pack.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - Wrecks Multi Pack NGPA Edition.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - Wrecks Multi Pack.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - Villa.zip | 2020-09-18 12:01 | 11M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - Skedar.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - NGPA Edition V1.1.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - NGPA Edition V1.0.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - NGPA Block Fort.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - Grid.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - Fortress.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - Chicago Patch.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - Banjo Kazooie Map Pack.zip | 2020-09-18 12:01 | 9.9M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 - BMW's Map Pack.zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye 007 (U) [!].zip | 2020-09-18 12:01 | 10M | |
![[ ]](/icons/compressed.gif) | GoldenEye - X [4.1].zip | 2020-09-18 12:01 | 28M | |
![[ ]](/icons/compressed.gif) | Goemon's Great Adventure (U) [!].zip | 2020-09-18 12:01 | 14M | |
![[ ]](/icons/compressed.gif) | Glover 2 (prototype).zip | 2020-09-18 12:01 | 18M | |
![[ ]](/icons/compressed.gif) | Glover (U) [!].zip | 2020-09-18 12:01 | 5.6M | |
![[ ]](/icons/compressed.gif) | Glover (E) (M3) [!].zip | 2020-09-18 12:01 | 5.6M | |
![[ ]](/icons/compressed.gif) | Gex 64 - Enter the Gecko (U) [!].zip | 2020-09-18 12:01 | 15M | |
![[ ]](/icons/compressed.gif) | Gex 3 - Deep Cover Gecko (U) [!].zip | 2020-09-18 12:01 | 25M | |
![[ ]](/icons/compressed.gif) | Gex 3 - Deep Cover Gecko (Europe) (En,Es,It).zip | 2020-09-18 12:01 | 23M | |
![[ ]](/icons/compressed.gif) | Getter Love!! Cho Renai Party Game (Japan).zip | 2020-09-18 12:01 | 8.2M | |
![[ ]](/icons/compressed.gif) | Gauntlet Legends (U) [!].zip | 2020-09-18 12:01 | 14M | |
![[ ]](/icons/compressed.gif) | Ganbare Goemon - Neo Momoyama Bakufu no Odori (Japan).zip | 2020-09-18 12:01 | 13M | |
![[ ]](/icons/compressed.gif) | Ganbare Goemon - Mononoke Sugoroku (J) [!].zip | 2020-09-18 12:01 | 13M | |
![[ ]](/icons/compressed.gif) | Ganbare Goemon - Dero Dero Douchuu Obake Tenkomori (Japan).zip | 2020-09-18 12:02 | 14M | |
![[ ]](/icons/compressed.gif) | GT 64 - Championship Edition (U) [!].zip | 2020-09-18 12:02 | 4.3M | |
![[ ]](/icons/compressed.gif) | G.A.S.P!! Fighters' NEXTream (Europe).zip | 2020-09-18 12:02 | 8.5M | |
![[ ]](/icons/compressed.gif) | Fushigi no Dungeon Fuurai no Shiren 2 - Oni Shuurai! Shiren Jou! (Japan).zip | 2020-09-18 12:02 | 22M | |
![[ ]](/icons/compressed.gif) | Frogger 2 (USA) (Rev A) (Proto).zip | 2020-09-18 12:02 | 3.1M | |
![[ ]](/icons/compressed.gif) | Fox Sports College Hoops '99 (U) [!].zip | 2020-09-18 12:02 | 9.3M | |
![[ ]](/icons/compressed.gif) | Forsaken 64 (U) [!].zip | 2020-09-18 12:02 | 6.7M | |
![[ ]](/icons/compressed.gif) | Flying Dragon (U) [!].zip | 2020-09-18 12:02 | 8.9M | |
![[ ]](/icons/compressed.gif) | Fighting Force 64 (U) [!].zip | 2020-09-18 12:02 | 9.8M | |
![[ ]](/icons/compressed.gif) | Fighter Destiny 2 (U) [!].zip | 2020-09-18 12:02 | 11M | |
![[ ]](/icons/compressed.gif) | Fighter's Destiny (U) [!].zip | 2020-09-18 12:02 | 8.5M | |
![[ ]](/icons/compressed.gif) | Famista 64 (Japan).zip | 2020-09-18 12:02 | 9.0M | |
![[ ]](/icons/compressed.gif) | FIFA Soccer 64 (U) (M3) [!].zip | 2020-09-18 12:02 | 6.2M | |
![[ ]](/icons/compressed.gif) | FIFA 99 (U) [!].zip | 2020-09-18 12:02 | 13M | |
![[ ]](/icons/compressed.gif) | FIFA - Road to World Cup 98 (U) [!].zip | 2020-09-18 12:02 | 9.9M | |
![[ ]](/icons/compressed.gif) | F1 Racing Championship (Europe) (En,Fr,De,Es,It).zip | 2020-09-18 12:02 | 14M | |
![[ ]](/icons/compressed.gif) | F-Zero X - New Lap.zip | 2020-09-18 12:02 | 12M | |
![[ ]](/icons/compressed.gif) | F-Zero X - Climax.zip | 2020-09-18 12:02 | 12M | |
![[ ]](/icons/compressed.gif) | F-Zero X - 2nd Boost.zip | 2020-09-18 12:02 | 12M | |
![[ ]](/icons/compressed.gif) | F-Zero DXP.zip | 2020-09-18 12:02 | 12M | |
![[ ]](/icons/compressed.gif) | F-ZERO X (U) [!].zip | 2020-09-18 12:02 | 12M | |
![[ ]](/icons/compressed.gif) | F-1 World Grand Prix II (Europe) (En,Fr,De,Es).zip | 2020-09-18 12:02 | 9.5M | |
![[ ]](/icons/compressed.gif) | F-1 World Grand Prix (U) [!].zip | 2020-09-18 12:02 | 9.0M | |
![[ ]](/icons/compressed.gif) | F-1 Pole Position 64 (U) [!].zip | 2020-09-18 12:02 | 5.9M | |
![[ ]](/icons/compressed.gif) | Extreme-G XG2 (U) [!].zip | 2020-09-18 12:02 | 11M | |
![[ ]](/icons/compressed.gif) | Extreme-G (U) [!].zip | 2020-09-18 12:02 | 7.6M | |
![[ ]](/icons/compressed.gif) | Excitebike 64 (U) [!].zip | 2020-09-18 12:02 | 15M | |
![[ ]](/icons/compressed.gif) | End of Days.zip | 2020-09-18 12:02 | 8.5M | |
![[ ]](/icons/compressed.gif) | Elmo's Number Journey (U) [!].zip | 2020-09-18 12:02 | 5.9M | |
![[ ]](/icons/compressed.gif) | Elmo's Letter Adventure (U) [!].zip | 2020-09-18 12:02 | 5.4M | |
![[ ]](/icons/compressed.gif) | Eikou no Saint Andrews (Japan).zip | 2020-09-18 12:02 | 6.2M | |
![[ ]](/icons/compressed.gif) | Earthworm Jim 3D (U) [!].zip | 2020-09-18 12:02 | 11M | |
![[ ]](/icons/compressed.gif) | ECW Hardcore Revolution (U) [!].zip | 2020-09-18 12:02 | 30M | |
![[ ]](/icons/compressed.gif) | Duke Nukem 64 (U) [!].zip | 2020-09-18 12:02 | 7.1M | |
![[ ]](/icons/compressed.gif) | Duke Nukem - ZER0 H0UR (U) [!].zip | 2020-09-18 12:02 | 24M | |
![[ ]](/icons/compressed.gif) | Duck Dodgers Starring Daffy Duck (U) [!].zip | 2020-09-18 12:02 | 13M | |
![[ ]](/icons/compressed.gif) | Dual Heroes (U) [!].zip | 2020-09-18 12:02 | 7.7M | |
![[ ]](/icons/compressed.gif) | Dr. Mario 64 (U) [!].zip | 2020-09-18 12:02 | 2.9M | |
![[ ]](/icons/compressed.gif) | Doubutsu no Mori (Japan).zip | 2020-09-18 12:02 | 11M | |
![[ ]](/icons/compressed.gif) | Doraemon 3 - Nobita no Machi SOS! (Japan).zip | 2020-09-18 12:02 | 12M | |
![[ ]](/icons/compressed.gif) | Doraemon 2 - Nobita to Hikari no Shinden (Japan).zip | 2020-09-18 12:02 | 7.3M | |
![[ ]](/icons/compressed.gif) | Doraemon - Nobita to 3tsu no Seireiseki (Japan).zip | 2020-09-18 12:02 | 4.5M | |
![[ ]](/icons/compressed.gif) | Doom 64 (U) [!].zip | 2020-09-18 12:02 | 7.0M | |
![[ ]](/icons/compressed.gif) | Doom 64 (E) [!].zip | 2020-09-18 12:02 | 7.0M | |
![[ ]](/icons/compressed.gif) | Donkey Kong 64 (U) [!].zip | 2020-09-18 12:03 | 26M | |
![[ ]](/icons/compressed.gif) | Donkey Kong 64 (J) [!].zip | 2020-09-18 12:03 | 26M | |
![[ ]](/icons/compressed.gif) | Disney's Tarzan (U) [!].zip | 2020-09-18 12:03 | 14M | |
![[ ]](/icons/compressed.gif) | Disney's Donald Duck - Goin' Quackers (U) [!].zip | 2020-09-18 12:02 | 11M | |
![[ ]](/icons/compressed.gif) | Diddy Kong Racing (U) (M2) (V1.1) [!].zip | 2020-09-18 12:03 | 9.8M | |
![[ ]](/icons/compressed.gif) | Dezaemon 3D (Japan).zip | 2020-09-18 12:03 | 9.6M | |
![[ ]](/icons/compressed.gif) | Destruction Derby 64 (U) [!].zip | 2020-09-18 12:03 | 9.8M | |
![[ ]](/icons/compressed.gif) | Derby Stallion 64 (Japan).zip | 2020-09-18 12:03 | 20M | |
![[ ]](/icons/compressed.gif) | Densha de Go! 64 (Japan).zip | 2020-09-18 12:03 | 19M | |
![[ ]](/icons/compressed.gif) | Defi au Tetris Magique (France).zip | 2020-09-18 12:03 | 11M | |
![[ ]](/icons/compressed.gif) | Deadly Arts (U) [!].zip | 2020-09-18 12:03 | 8.4M | |
![[ ]](/icons/compressed.gif) | Dark Rift (U) [!].zip | 2020-09-18 12:03 | 7.3M | |
![[ ]](/icons/compressed.gif) | Dark Rift (Europe).zip | 2020-09-18 12:03 | 7.3M | |
![[ ]](/icons/compressed.gif) | Dance Dance Revolution - Disney Dancing Museum (J) [!].zip | 2020-09-18 12:03 | 20M | |
![[ ]](/icons/compressed.gif) | Daffy Duck Starring as Duck Dodgers (Europe) (En,Fr,De,Es,It,Nl).zip | 2020-09-18 12:03 | 13M | |
![[ ]](/icons/compressed.gif) | CyberTiger (U) [!].zip | 2020-09-18 12:03 | 13M | |
![[ ]](/icons/compressed.gif) | Custom Robo V2 (Japan).zip | 2020-09-18 12:03 | 12M | |
![[ ]](/icons/compressed.gif) | Custom Robo (Japan).zip | 2020-09-18 12:03 | 11M | |
![[ ]](/icons/compressed.gif) | Cruis'n World (U) [!].zip | 2020-09-18 12:03 | 11M | |
![[ ]](/icons/compressed.gif) | Cruis'n USA (U) (V1.2) [!].zip | 2020-09-18 12:03 | 4.4M | |
![[ ]](/icons/compressed.gif) | Cruis'n Exotica (U) [!].zip | 2020-09-18 12:03 | 14M | |
![[ ]](/icons/compressed.gif) | Conker's Bad Fur Day (U) [!].zip | 2020-09-18 12:03 | 58M | |
![[ ]](/icons/compressed.gif) | Command & Conquer (U) [!].zip | 2020-09-18 12:03 | 13M | |
![[ ]](/icons/compressed.gif) | Clay Fighter 63 1-3 (U) [!].zip | 2020-09-18 12:03 | 9.8M | |
![[ ]](/icons/compressed.gif) | Clay Fighter - Sculptor's Cut (U) [!].zip | 2020-09-18 12:03 | 14M | |
![[ ]](/icons/compressed.gif) | City-Tour GP - Zennihon GT Senshuken (Japan).zip | 2020-09-18 12:03 | 6.3M | |
![[ ]](/icons/compressed.gif) | Chou Snobo Kids (Japan).zip | 2020-09-18 12:03 | 10M | |
![[ ]](/icons/compressed.gif) | Chou Kuukan Nighter Pro Yakyuu King 2 (Japan).zip | 2020-09-18 12:03 | 10M | |
![[ ]](/icons/compressed.gif) | Chou Kuukan Nighter Pro Yakyuu King (Japan).zip | 2020-09-18 12:03 | 6.6M | |
![[ ]](/icons/compressed.gif) | Choro Q 64 II - Hacha Mecha Grand Prix Race (Japan).zip | 2020-09-18 12:03 | 4.5M | |
![[ ]](/icons/compressed.gif) | Choro Q 64 (Japan).zip | 2020-09-18 12:03 | 2.5M | |
![[ ]](/icons/compressed.gif) | Chopper Attack (U) [!].zip | 2020-09-18 12:03 | 5.5M | |
![[ ]](/icons/compressed.gif) | Charlie Blast's Territory (U) [!].zip | 2020-09-18 12:03 | 1.1M | |
![[ ]](/icons/compressed.gif) | Chameleon Twist 2 (U) [!].zip | 2020-09-18 12:03 | 5.1M | |
![[ ]](/icons/compressed.gif) | Chameleon Twist (U) [!].zip | 2020-09-18 12:03 | 5.7M | |
![[ ]](/icons/compressed.gif) | Centre Court Tennis (Europe).zip | 2020-09-18 12:03 | 8.5M | |
![[ ]](/icons/compressed.gif) | Castlevania - Legacy of Darkness (U) [!].zip | 2020-09-18 12:03 | 13M | |
![[ ]](/icons/compressed.gif) | Castlevania (U) (V1.2) [!].zip | 2020-09-18 12:03 | 9.4M | |
![[ ]](/icons/compressed.gif) | Carmageddon 64 (U) [!].zip | 2020-09-18 12:03 | 12M | |
![[ ]](/icons/compressed.gif) | California Speed (U) [!].zip | 2020-09-18 12:03 | 14M | |
![[ ]](/icons/compressed.gif) | Bust-A-Move 2 - Arcade Edition (U) [!].zip | 2020-09-18 12:03 | 6.2M | |
![[ ]](/icons/compressed.gif) | Bust-A-Move '99 (U) [!].zip | 2020-09-18 12:03 | 6.7M | |
![[ ]](/icons/compressed.gif) | Bug's Life, A (U) [!].zip | 2020-09-18 12:03 | 11M | |
![[ ]](/icons/compressed.gif) | Buck Bumble (U) [!].zip | 2020-09-18 12:03 | 5.0M | |
![[ ]](/icons/compressed.gif) | Brunswick Circuit Pro Bowling (U) [!].zip | 2020-09-18 12:03 | 11M | |
![[ ]](/icons/compressed.gif) | Bounce Tales 64 1.0fix.zip | 2020-09-18 12:03 | 8.2M | |
![[ ]](/icons/compressed.gif) | Bottom of the 9th (U) [!].zip | 2020-09-18 12:03 | 13M | |
![[ ]](/icons/compressed.gif) | Bomberman Hero (U) [!].zip | 2020-09-18 12:03 | 9.4M | |
![[ ]](/icons/compressed.gif) | Bomberman Hero (E) [f1] (NTSC).zip | 2020-09-18 12:03 | 9.4M | |
![[ ]](/icons/compressed.gif) | Bomberman 64 - The Second Attack! (U) [!].zip | 2020-09-18 12:04 | 11M | |
![[ ]](/icons/compressed.gif) | Bomberman 64 (U) [!].zip | 2020-09-18 12:03 | 5.1M | |
![[ ]](/icons/compressed.gif) | Bomberman64 (Japan) (English).zip | 2020-09-18 12:03 | 7.9M | |
![[ ]](/icons/compressed.gif) | Bomberman 64 (Japan) (Arcade Edition).zip | 2020-09-18 12:03 | 6.7M | |
![[ ]](/icons/compressed.gif) | Bokujou Monogatari 2 (Japan).zip | 2020-09-18 12:04 | 6.6M | |
![[ ]](/icons/compressed.gif) | Body Harvest (U) [!].zip | 2020-09-18 12:04 | 6.8M | |
![[ ]](/icons/compressed.gif) | Blues Brothers 2000 (U) [!].zip | 2020-09-18 12:04 | 14M | |
![[ ]](/icons/compressed.gif) | Blastdozer (Japan).zip | 2020-09-18 12:04 | 6.9M | |
![[ ]](/icons/compressed.gif) | Blast Corps (U) (V1.0) [!].zip | 2020-09-18 12:04 | 6.9M | |
![[ ]](/icons/compressed.gif) | Blast Corps (Europe) (En,De).zip | 2020-09-18 12:04 | 6.9M | |
![[ ]](/icons/compressed.gif) | Bio F.R.E.A.K.S. (U) [!].zip | 2020-09-18 12:04 | 12M | |
![[ ]](/icons/compressed.gif) | Big Mountain 2000 (U) [!].zip | 2020-09-18 12:04 | 5.5M | |
![[ ]](/icons/compressed.gif) | Beetle Adventure Racing! (U) (M3) [!].zip | 2020-09-18 12:04 | 12M | |
![[ ]](/icons/compressed.gif) | Battlezone - Rise of the Black Dogs (U) [!].zip | 2020-09-18 12:04 | 11M | |
![[ ]](/icons/compressed.gif) | BattleTanx - Global Assault (U) [!].zip | 2020-09-18 12:04 | 4.5M | |
![[ ]](/icons/compressed.gif) | BattleTanx - Global Assault (Europe) (En,Fr,De).zip | 2020-09-18 12:04 | 4.6M | |
![[ ]](/icons/compressed.gif) | BattleTanx (U) [!].zip | 2020-09-18 12:04 | 4.9M | |
![[ ]](/icons/compressed.gif) | Batman of the Future - Return of the Joker (Europe) (En,Fr,De).zip | 2020-09-18 12:04 | 2.7M | |
![[ ]](/icons/compressed.gif) | Batman Beyond - Return of the Joker (U) [!].zip | 2020-09-18 12:04 | 5.4M | |
![[ ]](/icons/compressed.gif) | Bassmasters 2000 (U) [!].zip | 2020-09-18 12:04 | 9.2M | |
![[ ]](/icons/compressed.gif) | Bass Rush - ECOGEAR PowerWorm Championship (Japan).zip | 2020-09-18 12:04 | 14M | |
![[ ]](/icons/compressed.gif) | Banjo-Tooie (U) [!].zip | 2020-09-18 12:04 | 31M | |
![[ ]](/icons/compressed.gif) | Banjo-Tooie (E) [!].zip | 2020-09-18 12:04 | 31M | |
![[ ]](/icons/compressed.gif) | Banjo-Kazooie - Snowglow Village (demo).zip | 2020-09-18 12:04 | 15M | |
![[ ]](/icons/compressed.gif) | Banjo-Kazooie (U) [!].zip | 2020-09-18 12:04 | 16M | |
![[ ]](/icons/compressed.gif) | Bakushou Jinsei 64 - Mezase! Resort Ou (Japan).zip | 2020-09-18 12:04 | 7.3M | |
![[ ]](/icons/compressed.gif) | Bakuretsu Muteki Bangaioh (Japan).zip | 2020-09-18 12:04 | 7.4M | |
![[ ]](/icons/compressed.gif) | Automobili Lamborghini (U) [!].zip | 2020-09-18 12:04 | 2.7M | |
![[ ]](/icons/compressed.gif) | Asteroids Hyper 64 (U) [!].zip | 2020-09-18 12:04 | 5.5M | |
![[ ]](/icons/compressed.gif) | Army Men - Sarge's Heroes 2 (U) [!].zip | 2020-09-18 12:04 | 4.8M | |
![[ ]](/icons/compressed.gif) | Army Men - Sarge's Heroes (U) [!].zip | 2020-09-18 12:04 | 5.1M | |
![[ ]](/icons/compressed.gif) | Army Men - Air Combat (U) [!].zip | 2020-09-18 12:04 | 4.9M | |
![[ ]](/icons/compressed.gif) | Armorines - Project S.W.A.R.M. (U) [!].zip | 2020-09-18 12:04 | 13M | |
![[ ]](/icons/compressed.gif) | Animal Forest (english translation).zip | 2020-09-18 12:04 | 11M | |
![[ ]](/icons/compressed.gif) | All Star Tennis '99 (U) [!].zip | 2020-09-18 12:04 | 3.3M | |
![[ ]](/icons/compressed.gif) | All-Star Baseball 2001 (U) [!].zip | 2020-09-18 12:04 | 15M | |
![[ ]](/icons/compressed.gif) | All-Star Baseball 2000 (U) [!].zip | 2020-09-18 12:04 | 15M | |
![[ ]](/icons/compressed.gif) | All-Star Baseball '99 (U) [!].zip | 2020-09-18 12:04 | 11M | |
![[ ]](/icons/compressed.gif) | Akumajou Dracula Mokushiroku Gaiden - Legend of Cornell (Japan).zip | 2020-09-18 12:04 | 14M | |
![[ ]](/icons/compressed.gif) | Akumajou Dracula Mokushiroku - Real Action Adventure (Japan).zip | 2020-09-18 12:04 | 9.7M | |
![[ ]](/icons/compressed.gif) | Air Boarder 64 (Europe).zip | 2020-09-18 12:04 | 6.5M | |
![[ ]](/icons/compressed.gif) | Aidyn Chronicles - The First Mage (U) [!].zip | 2020-09-18 12:04 | 29M | |
![[ ]](/icons/compressed.gif) | AeroGauge (U) [!].zip | 2020-09-18 12:04 | 2.9M | |
![[ ]](/icons/compressed.gif) | AeroFighters Assault (U) [!].zip | 2020-09-18 12:04 | 4.8M | |
![[ ]](/icons/compressed.gif) | AI Shougi 3 (Japan).zip | 2020-09-18 12:04 | 3.0M | |
![[ ]](/icons/compressed.gif) | 1080 Snowboarding (JU) [!].zip | 2020-09-18 12:04 | 11M | |
![[ ]](/icons/compressed.gif) | 64 de Hakken!! Tamagotchi - Minna de Tamagotchi World (Japan).zip | 2020-09-18 12:04 | 9.7M | |
![[ ]](/icons/compressed.gif) | 64 Trump Collection - Alice no Wakuwaku Trump World (Japan).zip | 2020-09-18 12:04 | 6.3M | |
![[ ]](/icons/compressed.gif) | 64 Oozumou 2 (Japan).zip | 2020-09-18 12:04 | 8.6M | |
![[ ]](/icons/compressed.gif) | 64 Oozumou (Japan).zip | 2020-09-18 12:04 | 11M | |
![[ ]](/icons/compressed.gif) | 64 Hanafuda - Tenshi no Yakusoku (Japan).zip | 2020-09-18 12:04 | 3.8M | |
![[ ]](/icons/compressed.gif) | 40 Winks (Europe) (En,Es,It) (Proto).zip | 2020-09-18 12:05 | 29M | |
![[ ]](/icons/compressed.gif) | 4th Of July 64.zip | 2020-09-18 12:04 | 9.5M | |
![[ ]](/icons/compressed.gif) | 007 - The World is Not Enough (U) [!].zip | 2020-09-18 12:05 | 25M | |
|